ChemNet > CAS > 3033-82-7 8-Chloroquinaldine
3033-82-7 8-Chloroquinaldine
| product Name |
8-Chloroquinaldine |
| CAS No |
3033-82-7 |
| Synonyms |
8-Chloro-2-methylquinoline; 2-Methyl-8-chloroquinoline |
| Molecular Formula |
C10H8ClN |
| Molecular Weight |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
| Molecular Structure |
|
| Density |
1.225g/cm3 |
| Melting point |
64-66℃ |
| Boiling point |
278.2°C at 760 mmHg |
| Refractive index |
1.634 |
| Flash point |
148.7°C |
| Vapour Pressur |
0.00732mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
